C19H18O6 — CID 162947536
4-hydroxy-5,8-dimethyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one (PubChem CID 162947536) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-hydroxy-5,8-dimethyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one.
| Compound Name | 4-hydroxy-5,8-dimethyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one |
|---|---|
| PubChem CID | 162947536 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 4-hydroxy-5,8-dimethyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one |
| SMILES | CC1=CC(OC=C2C(=O)OC3c4c(C)ccc(C)c4C(O)C23)OC1=O |
| InChI | InChI=1S/C19H18O6/c1-8-4-5-9(2)14-13(8)16(20)15-11(19(22)25-17(14)15)7-23-12-6-10(3)18(21)24-12/h4-7,12,15-17,20H,1-3H3 |
| InChIKey | VTDCLRRDQIBELF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|