C15H18O5 — CID 143088484
(4Z,7E)-2,6-dimethyl-7-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3,6-dihydro-2H-oxocin-8-one (PubChem CID 143088484) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (4Z,7E)-2,6-dimethyl-7-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3,6-dihydro-2H-oxocin-8-one.
| Compound Name | (4Z,7E)-2,6-dimethyl-7-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3,6-dihydro-2H-oxocin-8-one |
|---|---|
| PubChem CID | 143088484 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (4Z,7E)-2,6-dimethyl-7-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3,6-dihydro-2H-oxocin-8-one |
| SMILES | CC1=CC(O/C=C2/C(=O)OC(C)C/C=C\C2C)OC1=O |
| InChI | InChI=1S/C15H18O5/c1-9-5-4-6-11(3)19-15(17)12(9)8-18-13-7-10(2)14(16)20-13/h4-5,7-9,11,13H,6H2,1-3H3/b5-4-,12-8+ |
| InChIKey | TYQLTLDWIYJFHH-KVIXIMHDSA-N |
| XLogP | 2.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|