C19H28N2O3 — CID 123601530
tert-butyl 3-(dimethylaminomethylidene)-2-oxo-4,4a,5,6,7,8b-hexahydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate (PubChem CID 123601530) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl 3-(dimethylaminomethylidene)-2-oxo-4,4a,5,6,7,8b-hexahydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-(dimethylaminomethylidene)-2-oxo-4,4a,5,6,7,8b-hexahydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 123601530 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl 3-(dimethylaminomethylidene)-2-oxo-4,4a,5,6,7,8b-hexahydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate |
| SMILES | CN(C)C=C1C(=O)N(C(=O)OC(C)(C)C)C2C3=CCCCC3CC12 |
| InChI | InChI=1S/C19H28N2O3/c1-19(2,3)24-18(23)21-16-13-9-7-6-8-12(13)10-14(16)15(17(21)22)11-20(4)5/h9,11-12,14,16H,6-8,10H2,1-5H3 |
| InChIKey | YAHWZIORELDDTE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|