C23H35NO3 — CID 122468621
tert-butyl (5R)-5-[[4-(cyclohexen-1-yl)cyclohexyl]methyl]-3-methylidene-2-oxopyrrolidine-1-carboxylate (PubChem CID 122468621) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is tert-butyl (5R)-5-[[4-(cyclohexen-1-yl)cyclohexyl]methyl]-3-methylidene-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5R)-5-[[4-(cyclohexen-1-yl)cyclohexyl]methyl]-3-methylidene-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 122468621 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | tert-butyl (5R)-5-[[4-(cyclohexen-1-yl)cyclohexyl]methyl]-3-methylidene-2-oxopyrrolidine-1-carboxylate |
| SMILES | C=C1C[C@@H](CC2CCC(C3=CCCCC3)CC2)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C23H35NO3/c1-16-14-20(24(21(16)25)22(26)27-23(2,3)4)15-17-10-12-19(13-11-17)18-8-6-5-7-9-18/h8,17,19-20H,1,5-7,9-15H2,2-4H3/t17?,19?,20-/m0/s1 |
| InChIKey | ANIYCZBXVDNKPK-UUKMXZOPSA-N |
| XLogP | 5.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|