C18H29NO3 — CID 107092130
tert-butyl 3-(cyclooctene-1-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 107092130) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is tert-butyl 3-(cyclooctene-1-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(cyclooctene-1-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107092130 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | tert-butyl 3-(cyclooctene-1-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)C2=CCCCCCC2)C1 |
| InChI | InChI=1S/C18H29NO3/c1-18(2,3)22-17(21)19-12-11-15(13-19)16(20)14-9-7-5-4-6-8-10-14/h9,15H,4-8,10-13H2,1-3H3 |
| InChIKey | USDLGUNXZVUEIO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |