C14H20ClN3O3 — CID 107092100
tert-butyl 3-(4-chloro-1-methylpyrazole-5-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 107092100) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is tert-butyl 3-(4-chloro-1-methylpyrazole-5-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-chloro-1-methylpyrazole-5-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107092100 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | tert-butyl 3-(4-chloro-1-methylpyrazole-5-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | Cn1ncc(Cl)c1C(=O)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H20ClN3O3/c1-14(2,3)21-13(20)18-6-5-9(8-18)12(19)11-10(15)7-16-17(11)4/h7,9H,5-6,8H2,1-4H3 |
| InChIKey | ATTJMJATAWCTHY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |