C11H18N2O3 — CID 58464091
tert-butyl (3aR,6aS)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazole-3-carboxylate (PubChem CID 58464091) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazole-3-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazole-3-carboxylate |
|---|---|
| PubChem CID | 58464091 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | tert-butyl (3aR,6aS)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)N[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C11H18N2O3/c1-11(2,3)16-10(15)13-8-6-4-5-7(8)12-9(13)14/h7-8H,4-6H2,1-3H3,(H,12,14)/t7-,8+/m0/s1 |
| InChIKey | WONFZQLPWSGYJI-JGVFFNPUSA-N |
| XLogP | 1.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |