C16H25NO4 — CID 90871417
tert-butyl 2-cyclohexyl-4,6-dioxopiperidine-1-carboxylate (PubChem CID 90871417) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl 2-cyclohexyl-4,6-dioxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-cyclohexyl-4,6-dioxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 90871417 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | tert-butyl 2-cyclohexyl-4,6-dioxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC(=O)CC1C1CCCCC1 |
| InChI | InChI=1S/C16H25NO4/c1-16(2,3)21-15(20)17-13(9-12(18)10-14(17)19)11-7-5-4-6-8-11/h11,13H,4-10H2,1-3H3 |
| InChIKey | JRRUWBNEWJZBMW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|