C19H20N2O4 — CID 118350165
(3E)-3-[[1-(methoxymethyl)-4-methyl-5-oxo-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one (PubChem CID 118350165) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (3E)-3-[[1-(methoxymethyl)-4-methyl-5-oxo-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one.
| Compound Name | (3E)-3-[[1-(methoxymethyl)-4-methyl-5-oxo-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 118350165 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3E)-3-[[1-(methoxymethyl)-4-methyl-5-oxo-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
| SMILES | COCN1C(=O)C(C)=CC1O/C=C1/C(=O)NC2c3ccccc3CC12 |
| InChI | InChI=1S/C19H20N2O4/c1-11-7-16(21(10-24-2)19(11)23)25-9-15-14-8-12-5-3-4-6-13(12)17(14)20-18(15)22/h3-7,9,14,16-17H,8,10H2,1-2H3,(H,20,22)/b15-9+ |
| InChIKey | JLGWWSKWAPGLSP-OQLLNIDSSA-N |
| XLogP | 1.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|