C18H16O4 — CID 10902534
(3E)-3-[2-(4-methyl-5-oxo-2H-furan-2-yl)ethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one (PubChem CID 10902534) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is (3E)-3-[2-(4-methyl-5-oxo-2H-furan-2-yl)ethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one.
| Compound Name | (3E)-3-[2-(4-methyl-5-oxo-2H-furan-2-yl)ethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one |
|---|---|
| PubChem CID | 10902534 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (3E)-3-[2-(4-methyl-5-oxo-2H-furan-2-yl)ethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one |
| SMILES | CC1=CC(C/C=C2/C(=O)OC3c4ccccc4CC23)OC1=O |
| InChI | InChI=1S/C18H16O4/c1-10-8-12(21-17(10)19)6-7-14-15-9-11-4-2-3-5-13(11)16(15)22-18(14)20/h2-5,7-8,12,15-16H,6,9H2,1H3/b14-7+ |
| InChIKey | IFPRJYMPRBUUTK-VGOFMYFVSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|