C12H12 — CID 134992429
1-methyl-7,7a-dihydro-2aH-cyclobuta[a]indene (PubChem CID 134992429) has the molecular formula C12H12 and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-methyl-7,7a-dihydro-2aH-cyclobuta[a]indene.
| Compound Name | 1-methyl-7,7a-dihydro-2aH-cyclobuta[a]indene |
|---|---|
| PubChem CID | 134992429 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-methyl-7,7a-dihydro-2aH-cyclobuta[a]indene |
| SMILES | CC1=CC2c3ccccc3CC12 |
| InChI | InChI=1S/C12H12/c1-8-6-12-10-5-3-2-4-9(10)7-11(8)12/h2-6,11-12H,7H2,1H3 |
| InChIKey | PGLDEGHQJCXUCV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|