C25H21F3N2O3 — CID 123908889
3-[[3,4-dimethyl-5-oxo-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one (PubChem CID 123908889) has the molecular formula C25H21F3N2O3 and a molecular weight of 454.45 g/mol. Its IUPAC name is 3-[[3,4-dimethyl-5-oxo-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one.
| Compound Name | 3-[[3,4-dimethyl-5-oxo-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 123908889 |
| Molecular Formula | C25H21F3N2O3 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 3-[[3,4-dimethyl-5-oxo-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-yl]oxymethylidene]-1,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
| SMILES | CC1=C(C)C(OC=C2C(=O)NC3c4ccccc4CC23)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C25H21F3N2O3/c1-13-14(2)24(30(23(13)32)17-8-5-7-16(11-17)25(26,27)28)33-12-20-19-10-15-6-3-4-9-18(15)21(19)29-22(20)31/h3-9,11-12,19,21,24H,10H2,1-2H3,(H,29,31) |
| InChIKey | LDMWEHUQZQCGEB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|