C21H15F3N2O2 — CID 60587937
2-(2-hydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one (PubChem CID 60587937) has the molecular formula C21H15F3N2O2 and a molecular weight of 384.36 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | 2-(2-hydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 60587937 |
| Molecular Formula | C21H15F3N2O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-(2-hydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2NC(c2ccccc2O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H15F3N2O2/c22-21(23,24)13-6-5-7-14(12-13)26-19(16-9-2-4-11-18(16)27)25-17-10-3-1-8-15(17)20(26)28/h1-12,19,25,27H |
| InChIKey | SMJXBYXMEPPSJL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|