C20H13Br2FN2O2 — CID 176687452
2-(3,5-dibromo-2-hydroxyphenyl)-3-(4-fluorophenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 176687452) has the molecular formula C20H13Br2FN2O2 and a molecular weight of 492.14 g/mol. Its IUPAC name is 2-(3,5-dibromo-2-hydroxyphenyl)-3-(4-fluorophenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 2-(3,5-dibromo-2-hydroxyphenyl)-3-(4-fluorophenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 176687452 |
| Molecular Formula | C20H13Br2FN2O2 |
| Molecular Weight | 492.14 g/mol |
| Exact Mass | 489.93 |
| IUPAC Name | 2-(3,5-dibromo-2-hydroxyphenyl)-3-(4-fluorophenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2NC(c2cc(Br)cc(Br)c2O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H13Br2FN2O2/c21-11-9-15(18(26)16(22)10-11)19-24-17-4-2-1-3-14(17)20(27)25(19)13-7-5-12(23)6-8-13/h1-10,19,24,26H |
| InChIKey | ATODNJHAKZKNAR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.14 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|