C18H13FN2O2 — CID 7027322
(2R)-3-(4-fluorophenyl)-2-(furan-2-yl)-1,2-dihydroquinazolin-4-one (PubChem CID 7027322) has the molecular formula C18H13FN2O2 and a molecular weight of 308.31 g/mol. Its IUPAC name is (2R)-3-(4-fluorophenyl)-2-(furan-2-yl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-3-(4-fluorophenyl)-2-(furan-2-yl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 7027322 |
| Molecular Formula | C18H13FN2O2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2R)-3-(4-fluorophenyl)-2-(furan-2-yl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@@H](c2ccco2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13FN2O2/c19-12-7-9-13(10-8-12)21-17(16-6-3-11-23-16)20-15-5-2-1-4-14(15)18(21)22/h1-11,17,20H/t17-/m1/s1 |
| InChIKey | LXRXJADOPPOVEO-QGZVFWFLSA-N |
| XLogP | 4.19 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |