C20H13ClFN3O3 — CID 34852320
(2S)-2-(5-chloro-2-nitrophenyl)-3-(4-fluorophenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 34852320) has the molecular formula C20H13ClFN3O3 and a molecular weight of 397.79 g/mol. Its IUPAC name is (2S)-2-(5-chloro-2-nitrophenyl)-3-(4-fluorophenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-2-(5-chloro-2-nitrophenyl)-3-(4-fluorophenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 34852320 |
| Molecular Formula | C20H13ClFN3O3 |
| Molecular Weight | 397.79 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | (2S)-2-(5-chloro-2-nitrophenyl)-3-(4-fluorophenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@H](c2cc(Cl)ccc2[N+](=O)[O-])N1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H13ClFN3O3/c21-12-5-10-18(25(27)28)16(11-12)19-23-17-4-2-1-3-15(17)20(26)24(19)14-8-6-13(22)7-9-14/h1-11,19,23H/t19-/m0/s1 |
| InChIKey | RGECOJXSTLTZTN-IBGZPJMESA-N |
| XLogP | 5.16 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.79 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|