C21H14FN3O5 — CID 9011893
(2R)-3-(4-fluorophenyl)-2-(6-nitro-1,3-benzodioxol-5-yl)-1,2-dihydroquinazolin-4-one (PubChem CID 9011893) has the molecular formula C21H14FN3O5 and a molecular weight of 407.36 g/mol. Its IUPAC name is (2R)-3-(4-fluorophenyl)-2-(6-nitro-1,3-benzodioxol-5-yl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-3-(4-fluorophenyl)-2-(6-nitro-1,3-benzodioxol-5-yl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9011893 |
| Molecular Formula | C21H14FN3O5 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (2R)-3-(4-fluorophenyl)-2-(6-nitro-1,3-benzodioxol-5-yl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@@H](c2cc3c(cc2[N+](=O)[O-])OCO3)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H14FN3O5/c22-12-5-7-13(8-6-12)24-20(23-16-4-2-1-3-14(16)21(24)26)15-9-18-19(30-11-29-18)10-17(15)25(27)28/h1-10,20,23H,11H2/t20-/m1/s1 |
| InChIKey | QQVVOFCKHLFRNI-HXUWFJFHSA-N |
| XLogP | 4.23 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|