C18H14N4O4 — CID 135619010
(5R)-2-methyl-5-(6-nitro-1,3-benzodioxol-5-yl)-5,6-dihydropyrazolo[1,5-c]quinazoline (PubChem CID 135619010) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is (5R)-2-methyl-5-(6-nitro-1,3-benzodioxol-5-yl)-5,6-dihydropyrazolo[1,5-c]quinazoline.
| Compound Name | (5R)-2-methyl-5-(6-nitro-1,3-benzodioxol-5-yl)-5,6-dihydropyrazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 135619010 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (5R)-2-methyl-5-(6-nitro-1,3-benzodioxol-5-yl)-5,6-dihydropyrazolo[1,5-c]quinazoline |
| SMILES | Cc1cc2n(n1)[C@H](c1cc3c(cc1[N+](=O)[O-])OCO3)Nc1ccccc1-2 |
| InChI | InChI=1S/C18H14N4O4/c1-10-6-14-11-4-2-3-5-13(11)19-18(21(14)20-10)12-7-16-17(26-9-25-16)8-15(12)22(23)24/h2-8,18-19H,9H2,1H3/t18-/m1/s1 |
| InChIKey | XXRRBUKRXHKBDY-GOSISDBHSA-N |
| XLogP | 3.47 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|