C25H19N5O5S — CID 26366267
(6R)-3-[(4-methylphenyl)methylsulfanyl]-6-(6-nitro-1,3-benzodioxol-5-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 26366267) has the molecular formula C25H19N5O5S and a molecular weight of 501.52 g/mol. Its IUPAC name is (6R)-3-[(4-methylphenyl)methylsulfanyl]-6-(6-nitro-1,3-benzodioxol-5-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-3-[(4-methylphenyl)methylsulfanyl]-6-(6-nitro-1,3-benzodioxol-5-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 26366267 |
| Molecular Formula | C25H19N5O5S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | (6R)-3-[(4-methylphenyl)methylsulfanyl]-6-(6-nitro-1,3-benzodioxol-5-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | Cc1ccc(CSc2nnc3c(n2)O[C@H](c2cc4c(cc2[N+](=O)[O-])OCO4)Nc2ccccc2-3)cc1 |
| InChI | InChI=1S/C25H19N5O5S/c1-14-6-8-15(9-7-14)12-36-25-27-24-22(28-29-25)16-4-2-3-5-18(16)26-23(35-24)17-10-20-21(34-13-33-20)11-19(17)30(31)32/h2-11,23,26H,12-13H2,1H3/t23-/m1/s1 |
| InChIKey | SKHKYTQPLKYZMU-HSZRJFAPSA-N |
| XLogP | 5.28 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|