C24H17ClN4O3S — CID 6408690
(6S)-3-benzylsulfanyl-6-(6-chloro-1,3-benzodioxol-5-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 6408690) has the molecular formula C24H17ClN4O3S and a molecular weight of 476.95 g/mol. Its IUPAC name is (6S)-3-benzylsulfanyl-6-(6-chloro-1,3-benzodioxol-5-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6S)-3-benzylsulfanyl-6-(6-chloro-1,3-benzodioxol-5-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 6408690 |
| Molecular Formula | C24H17ClN4O3S |
| Molecular Weight | 476.95 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | (6S)-3-benzylsulfanyl-6-(6-chloro-1,3-benzodioxol-5-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | Clc1cc2c(cc1[C@H]1Nc3ccccc3-c3nnc(SCc4ccccc4)nc3O1)OCO2 |
| InChI | InChI=1S/C24H17ClN4O3S/c25-17-11-20-19(30-13-31-20)10-16(17)22-26-18-9-5-4-8-15(18)21-23(32-22)27-24(29-28-21)33-12-14-6-2-1-3-7-14/h1-11,22,26H,12-13H2/t22-/m0/s1 |
| InChIKey | CFWGSTCAICMBKZ-QFIPXVFZSA-N |
| XLogP | 5.72 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.95 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |