C25H21ClN4O3S — CID 6407824
(6R)-3-benzylsulfanyl-6-(2-chloro-4,5-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 6407824) has the molecular formula C25H21ClN4O3S and a molecular weight of 492.99 g/mol. Its IUPAC name is (6R)-3-benzylsulfanyl-6-(2-chloro-4,5-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-3-benzylsulfanyl-6-(2-chloro-4,5-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 6407824 |
| Molecular Formula | C25H21ClN4O3S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | (6R)-3-benzylsulfanyl-6-(2-chloro-4,5-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | COc1cc(Cl)c([C@@H]2Nc3ccccc3-c3nnc(SCc4ccccc4)nc3O2)cc1OC |
| InChI | InChI=1S/C25H21ClN4O3S/c1-31-20-12-17(18(26)13-21(20)32-2)23-27-19-11-7-6-10-16(19)22-24(33-23)28-25(30-29-22)34-14-15-8-4-3-5-9-15/h3-13,23,27H,14H2,1-2H3/t23-/m1/s1 |
| InChIKey | KIHVYPLDAAILSP-HSZRJFAPSA-N |
| XLogP | 6.00 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |