C21H22N4O4S — CID 6415533
3-ethylsulfanyl-6-(2,4,5-trimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 6415533) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 3-ethylsulfanyl-6-(2,4,5-trimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 3-ethylsulfanyl-6-(2,4,5-trimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 6415533 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3-ethylsulfanyl-6-(2,4,5-trimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCSc1nnc2c(n1)OC(c1cc(OC)c(OC)cc1OC)Nc1ccccc1-2 |
| InChI | InChI=1S/C21H22N4O4S/c1-5-30-21-23-20-18(24-25-21)12-8-6-7-9-14(12)22-19(29-20)13-10-16(27-3)17(28-4)11-15(13)26-2/h6-11,19,22H,5H2,1-4H3 |
| InChIKey | IAVCKVGDSHUADN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |