C21H16N4O3 — CID 4032556
2-methyl-5-[5-(3-nitrophenyl)furan-2-yl]-5,6-dihydropyrazolo[1,5-c]quinazoline (PubChem CID 4032556) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-methyl-5-[5-(3-nitrophenyl)furan-2-yl]-5,6-dihydropyrazolo[1,5-c]quinazoline.
| Compound Name | 2-methyl-5-[5-(3-nitrophenyl)furan-2-yl]-5,6-dihydropyrazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 4032556 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-methyl-5-[5-(3-nitrophenyl)furan-2-yl]-5,6-dihydropyrazolo[1,5-c]quinazoline |
| SMILES | Cc1cc2n(n1)C(c1ccc(-c3cccc([N+](=O)[O-])c3)o1)Nc1ccccc1-2 |
| InChI | InChI=1S/C21H16N4O3/c1-13-11-18-16-7-2-3-8-17(16)22-21(24(18)23-13)20-10-9-19(28-20)14-5-4-6-15(12-14)25(26)27/h2-12,21-22H,1H3 |
| InChIKey | FXZFGAQNRNDWIP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 86.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|