C18H12ClN2O3- — CID 4744926
2-[5-(3-chlorophenyl)furan-2-yl]-3-oxido-1,2-dihydroquinazolin-4-one (PubChem CID 4744926) has the molecular formula C18H12ClN2O3- and a molecular weight of 339.76 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)furan-2-yl]-3-oxido-1,2-dihydroquinazolin-4-one.
| Compound Name | 2-[5-(3-chlorophenyl)furan-2-yl]-3-oxido-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 4744926 |
| Molecular Formula | C18H12ClN2O3- |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-[5-(3-chlorophenyl)furan-2-yl]-3-oxido-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2NC(c2ccc(-c3cccc(Cl)c3)o2)N1[O-] |
| InChI | InChI=1S/C18H12ClN2O3/c19-12-5-3-4-11(10-12)15-8-9-16(24-15)17-20-14-7-2-1-6-13(14)18(22)21(17)23/h1-10,17,20H/q-1 |
| InChIKey | OGQQASRCZCVRFM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |