C15H10F3N2O2- — CID 4744964
3-oxido-2-[2-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one (PubChem CID 4744964) has the molecular formula C15H10F3N2O2- and a molecular weight of 307.25 g/mol. Its IUPAC name is 3-oxido-2-[2-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-oxido-2-[2-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 4744964 |
| Molecular Formula | C15H10F3N2O2- |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-oxido-2-[2-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2NC(c2ccccc2C(F)(F)F)N1[O-] |
| InChI | InChI=1S/C15H10F3N2O2/c16-15(17,18)11-7-3-1-5-9(11)13-19-12-8-4-2-6-10(12)14(21)20(13)22/h1-8,13,19H/q-1 |
| InChIKey | TUFKWKNTOOMSTP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |