C18H15F3N4OS — CID 137238189
(6R,11bR)-3-methylsulfanyl-6-[2-(trifluoromethyl)phenyl]-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137238189) has the molecular formula C18H15F3N4OS and a molecular weight of 392.41 g/mol. Its IUPAC name is (6R,11bR)-3-methylsulfanyl-6-[2-(trifluoromethyl)phenyl]-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R,11bR)-3-methylsulfanyl-6-[2-(trifluoromethyl)phenyl]-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137238189 |
| Molecular Formula | C18H15F3N4OS |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (6R,11bR)-3-methylsulfanyl-6-[2-(trifluoromethyl)phenyl]-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CSC1=NN2[C@H](c3ccccc3C(F)(F)F)Nc3ccccc3[C@@H]2C(=O)N1 |
| InChI | InChI=1S/C18H15F3N4OS/c1-27-17-23-16(26)14-11-7-3-5-9-13(11)22-15(25(14)24-17)10-6-2-4-8-12(10)18(19,20)21/h2-9,14-15,22H,1H3,(H,23,24,26)/t14-,15-/m1/s1 |
| InChIKey | VVBJLPYVONNUOZ-HUUCEWRRSA-N |
| XLogP | 3.94 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |