C13H16N4OS — CID 137238083
(6R,11bS)-3-ethylsulfanyl-6-methyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137238083) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is (6R,11bS)-3-ethylsulfanyl-6-methyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R,11bS)-3-ethylsulfanyl-6-methyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137238083 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (6R,11bS)-3-ethylsulfanyl-6-methyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCSC1=NN2[C@H](C)Nc3ccccc3[C@H]2C(=O)N1 |
| InChI | InChI=1S/C13H16N4OS/c1-3-19-13-15-12(18)11-9-6-4-5-7-10(9)14-8(2)17(11)16-13/h4-8,11,14H,3H2,1-2H3,(H,15,16,18)/t8-,11+/m1/s1 |
| InChIKey | NIACJEQBLWZNMP-KCJUWKMLSA-N |
| XLogP | 1.96 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |