C17H15N5O4S — CID 137237937
(6S,11bR)-6-(5-nitrofuran-2-yl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237937) has the molecular formula C17H15N5O4S and a molecular weight of 385.41 g/mol. Its IUPAC name is (6S,11bR)-6-(5-nitrofuran-2-yl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S,11bR)-6-(5-nitrofuran-2-yl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237937 |
| Molecular Formula | C17H15N5O4S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (6S,11bR)-6-(5-nitrofuran-2-yl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2[C@@H](c3ccc([N+](=O)[O-])o3)Nc3ccccc3[C@@H]2C(=O)N1 |
| InChI | InChI=1S/C17H15N5O4S/c1-2-9-27-17-19-16(23)14-10-5-3-4-6-11(10)18-15(21(14)20-17)12-7-8-13(26-12)22(24)25/h2-8,14-15,18H,1,9H2,(H,19,20,23)/t14-,15+/m1/s1 |
| InChIKey | BKNFCWWFACNWAO-CABCVRRESA-N |
| XLogP | 2.98 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|