C23H20N4OS — CID 137237965
(6R,11bS)-6-naphthalen-1-yl-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237965) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is (6R,11bS)-6-naphthalen-1-yl-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R,11bS)-6-naphthalen-1-yl-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237965 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (6R,11bS)-6-naphthalen-1-yl-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2[C@H](C(=O)N1)c1ccccc1N[C@H]2c1cccc2ccccc12 |
| InChI | InChI=1S/C23H20N4OS/c1-2-14-29-23-25-22(28)20-18-11-5-6-13-19(18)24-21(27(20)26-23)17-12-7-9-15-8-3-4-10-16(15)17/h2-13,20-21,24H,1,14H2,(H,25,26,28)/t20-,21+/m0/s1 |
| InChIKey | CTXWAHPDHUEVQZ-LEWJYISDSA-N |
| XLogP | 4.63 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|