C16H15BrN4OS2 — CID 137238206
(6S,11bR)-6-(5-bromothiophen-2-yl)-3-ethylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137238206) has the molecular formula C16H15BrN4OS2 and a molecular weight of 423.36 g/mol. Its IUPAC name is (6S,11bR)-6-(5-bromothiophen-2-yl)-3-ethylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S,11bR)-6-(5-bromothiophen-2-yl)-3-ethylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137238206 |
| Molecular Formula | C16H15BrN4OS2 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | (6S,11bR)-6-(5-bromothiophen-2-yl)-3-ethylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCSC1=NN2[C@@H](c3ccc(Br)s3)Nc3ccccc3[C@@H]2C(=O)N1 |
| InChI | InChI=1S/C16H15BrN4OS2/c1-2-23-16-19-15(22)13-9-5-3-4-6-10(9)18-14(21(13)20-16)11-7-8-12(17)24-11/h3-8,13-14,18H,2H2,1H3,(H,19,20,22)/t13-,14+/m1/s1 |
| InChIKey | XRQBQXDYSRTHKB-KGLIPLIRSA-N |
| XLogP | 4.13 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |