C21H22N4OS — CID 137237942
(6S,11bS)-6-(2,5-dimethylphenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237942) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is (6S,11bS)-6-(2,5-dimethylphenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S,11bS)-6-(2,5-dimethylphenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237942 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (6S,11bS)-6-(2,5-dimethylphenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2[C@@H](c3cc(C)ccc3C)Nc3ccccc3[C@H]2C(=O)N1 |
| InChI | InChI=1S/C21H22N4OS/c1-4-11-27-21-23-20(26)18-15-7-5-6-8-17(15)22-19(25(18)24-21)16-12-13(2)9-10-14(16)3/h4-10,12,18-19,22H,1,11H2,2-3H3,(H,23,24,26)/t18-,19-/m0/s1 |
| InChIKey | BNEHBNXJIXMEJJ-OALUTQOASA-N |
| XLogP | 4.09 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|