C19H16ClN5O3S — CID 137238197
(6S,11bS)-6-(2-chloro-5-nitrophenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137238197) has the molecular formula C19H16ClN5O3S and a molecular weight of 429.89 g/mol. Its IUPAC name is (6S,11bS)-6-(2-chloro-5-nitrophenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S,11bS)-6-(2-chloro-5-nitrophenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137238197 |
| Molecular Formula | C19H16ClN5O3S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | (6S,11bS)-6-(2-chloro-5-nitrophenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2[C@@H](c3cc([N+](=O)[O-])ccc3Cl)Nc3ccccc3[C@H]2C(=O)N1 |
| InChI | InChI=1S/C19H16ClN5O3S/c1-2-9-29-19-22-18(26)16-12-5-3-4-6-15(12)21-17(24(16)23-19)13-10-11(25(27)28)7-8-14(13)20/h2-8,10,16-17,21H,1,9H2,(H,22,23,26)/t16-,17-/m0/s1 |
| InChIKey | VYADECFVXLCPNT-IRXDYDNUSA-N |
| XLogP | 4.04 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|