C17H14ClN5O3S — CID 137238007
(6S,11bR)-6-(2-chloro-5-nitrophenyl)-3-methylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137238007) has the molecular formula C17H14ClN5O3S and a molecular weight of 403.85 g/mol. Its IUPAC name is (6S,11bR)-6-(2-chloro-5-nitrophenyl)-3-methylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S,11bR)-6-(2-chloro-5-nitrophenyl)-3-methylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137238007 |
| Molecular Formula | C17H14ClN5O3S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | (6S,11bR)-6-(2-chloro-5-nitrophenyl)-3-methylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CSC1=NN2[C@@H](c3cc([N+](=O)[O-])ccc3Cl)Nc3ccccc3[C@@H]2C(=O)N1 |
| InChI | InChI=1S/C17H14ClN5O3S/c1-27-17-20-16(24)14-10-4-2-3-5-13(10)19-15(22(14)21-17)11-8-9(23(25)26)6-7-12(11)18/h2-8,14-15,19H,1H3,(H,20,21,24)/t14-,15+/m1/s1 |
| InChIKey | HRCAWCIFOWQFOI-CABCVRRESA-N |
| XLogP | 3.48 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|