C26H23BrN4O2S — CID 137238073
(6S,11bS)-6-(5-bromo-2-phenylmethoxyphenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137238073) has the molecular formula C26H23BrN4O2S and a molecular weight of 535.47 g/mol. Its IUPAC name is (6S,11bS)-6-(5-bromo-2-phenylmethoxyphenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S,11bS)-6-(5-bromo-2-phenylmethoxyphenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137238073 |
| Molecular Formula | C26H23BrN4O2S |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | (6S,11bS)-6-(5-bromo-2-phenylmethoxyphenyl)-3-prop-2-enylsulfanyl-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2[C@@H](c3cc(Br)ccc3OCc3ccccc3)Nc3ccccc3[C@H]2C(=O)N1 |
| InChI | InChI=1S/C26H23BrN4O2S/c1-2-14-34-26-29-25(32)23-19-10-6-7-11-21(19)28-24(31(23)30-26)20-15-18(27)12-13-22(20)33-16-17-8-4-3-5-9-17/h2-13,15,23-24,28H,1,14,16H2,(H,29,30,32)/t23-,24-/m0/s1 |
| InChIKey | LOHPJNXATPDFPP-ZEQRLZLVSA-N |
| XLogP | 5.82 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|