C20H16BrNO2S2 — CID 2299325
(4E)-4-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one (PubChem CID 2299325) has the molecular formula C20H16BrNO2S2 and a molecular weight of 446.39 g/mol. Its IUPAC name is (4E)-4-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one.
| Compound Name | (4E)-4-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2299325 |
| Molecular Formula | C20H16BrNO2S2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | (4E)-4-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one |
| SMILES | C=CCSC1=N/C(=C/c2cc(Br)ccc2OCc2ccccc2)C(=O)S1 |
| InChI | InChI=1S/C20H16BrNO2S2/c1-2-10-25-20-22-17(19(23)26-20)12-15-11-16(21)8-9-18(15)24-13-14-6-4-3-5-7-14/h2-9,11-12H,1,10,13H2/b17-12+ |
| InChIKey | XEBUKTNTMJPBNP-SFQUDFHCSA-N |
| XLogP | 5.92 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_N(1)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|