C23H15BrClNO3 — CID 21216669
(4Z)-4-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-(2-chlorophenyl)-1,3-oxazol-5-one (PubChem CID 21216669) has the molecular formula C23H15BrClNO3 and a molecular weight of 468.73 g/mol. Its IUPAC name is (4Z)-4-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-(2-chlorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-(2-chlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 21216669 |
| Molecular Formula | C23H15BrClNO3 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 466.99 |
| IUPAC Name | (4Z)-4-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-(2-chlorophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2Cl)=N/C1=C\c1cc(Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H15BrClNO3/c24-17-10-11-21(28-14-15-6-2-1-3-7-15)16(12-17)13-20-23(27)29-22(26-20)18-8-4-5-9-19(18)25/h1-13H,14H2/b20-13- |
| InChIKey | MHFFHZFQGCPGDX-MOSHPQCFSA-N |
| XLogP | 6.03 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|