C21H18BrNO3S2 — CID 2297299
(4Z)-4-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one (PubChem CID 2297299) has the molecular formula C21H18BrNO3S2 and a molecular weight of 476.42 g/mol. Its IUPAC name is (4Z)-4-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one.
| Compound Name | (4Z)-4-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2297299 |
| Molecular Formula | C21H18BrNO3S2 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | (4Z)-4-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one |
| SMILES | C=CCSC1=N/C(=C\c2cc(Br)c(OCc3ccccc3)c(OC)c2)C(=O)S1 |
| InChI | InChI=1S/C21H18BrNO3S2/c1-3-9-27-21-23-17(20(24)28-21)11-15-10-16(22)19(18(12-15)25-2)26-13-14-7-5-4-6-8-14/h3-8,10-12H,1,9,13H2,2H3/b17-11- |
| InChIKey | SUZWXSBRMVKCMY-BOPFTXTBSA-N |
| XLogP | 5.93 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|