C19H16BrNO3S2 — CID 2234975
(4E)-4-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one (PubChem CID 2234975) has the molecular formula C19H16BrNO3S2 and a molecular weight of 450.38 g/mol. Its IUPAC name is (4E)-4-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one.
| Compound Name | (4E)-4-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2234975 |
| Molecular Formula | C19H16BrNO3S2 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 448.98 |
| IUPAC Name | (4E)-4-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one |
| SMILES | COc1cc(/C=C2/N=C(SC)SC2=O)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C19H16BrNO3S2/c1-23-16-10-13(9-15-18(22)26-19(21-15)25-2)8-14(20)17(16)24-11-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3/b15-9+ |
| InChIKey | BBHQVWLCMAPUFD-OQLLNIDSSA-N |
| XLogP | 5.37 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|