C15H12BrNO3S2 — CID 2297026
[2-bromo-4-[(E)-(5-oxo-2-prop-2-enylsulfanyl-1,3-thiazol-4-ylidene)methyl]phenyl] acetate (PubChem CID 2297026) has the molecular formula C15H12BrNO3S2 and a molecular weight of 398.30 g/mol. Its IUPAC name is [2-bromo-4-[(E)-(5-oxo-2-prop-2-enylsulfanyl-1,3-thiazol-4-ylidene)methyl]phenyl] acetate.
| Compound Name | [2-bromo-4-[(E)-(5-oxo-2-prop-2-enylsulfanyl-1,3-thiazol-4-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 2297026 |
| Molecular Formula | C15H12BrNO3S2 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 396.94 |
| IUPAC Name | [2-bromo-4-[(E)-(5-oxo-2-prop-2-enylsulfanyl-1,3-thiazol-4-ylidene)methyl]phenyl] acetate |
| SMILES | C=CCSC1=N/C(=C/c2ccc(OC(C)=O)c(Br)c2)C(=O)S1 |
| InChI | InChI=1S/C15H12BrNO3S2/c1-3-6-21-15-17-12(14(19)22-15)8-10-4-5-13(11(16)7-10)20-9(2)18/h3-5,7-8H,1,6H2,2H3/b12-8+ |
| InChIKey | QBWLWPNPSQFGDT-XYOKQWHBSA-N |
| XLogP | 4.26 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|