C13H10BrNO3S2 — CID 2934210
[4-bromo-3-[(2-methylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]phenyl] acetate (PubChem CID 2934210) has the molecular formula C13H10BrNO3S2 and a molecular weight of 372.27 g/mol. Its IUPAC name is [4-bromo-3-[(2-methylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]phenyl] acetate.
| Compound Name | [4-bromo-3-[(2-methylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 2934210 |
| Molecular Formula | C13H10BrNO3S2 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | [4-bromo-3-[(2-methylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]phenyl] acetate |
| SMILES | CSC1=NC(=Cc2cc(OC(C)=O)ccc2Br)C(=O)S1 |
| InChI | InChI=1S/C13H10BrNO3S2/c1-7(16)18-9-3-4-10(14)8(5-9)6-11-12(17)20-13(15-11)19-2/h3-6H,1-2H3 |
| InChIKey | JOPGBTYPDKHGFE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|