C13H10NO4S2- — CID 2278495
2-[4-[(Z)-(2-methylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]phenoxy]acetate (PubChem CID 2278495) has the molecular formula C13H10NO4S2- and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[4-[(Z)-(2-methylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-(2-methylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2278495 |
| Molecular Formula | C13H10NO4S2- |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2-[4-[(Z)-(2-methylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]phenoxy]acetate |
| SMILES | CSC1=N/C(=C\c2ccc(OCC(=O)[O-])cc2)C(=O)S1 |
| InChI | InChI=1S/C13H11NO4S2/c1-19-13-14-10(12(17)20-13)6-8-2-4-9(5-3-8)18-7-11(15)16/h2-6H,7H2,1H3,(H,15,16)/p-1/b10-6- |
| InChIKey | HXPJYROAKPSDQS-POHAHGRESA-M |
| XLogP | 1.15 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|