C20H19NO2S2 — CID 2181241
(4Z)-4-[(4-phenylmethoxyphenyl)methylidene]-2-propylsulfanyl-1,3-thiazol-5-one (PubChem CID 2181241) has the molecular formula C20H19NO2S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is (4Z)-4-[(4-phenylmethoxyphenyl)methylidene]-2-propylsulfanyl-1,3-thiazol-5-one.
| Compound Name | (4Z)-4-[(4-phenylmethoxyphenyl)methylidene]-2-propylsulfanyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2181241 |
| Molecular Formula | C20H19NO2S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | (4Z)-4-[(4-phenylmethoxyphenyl)methylidene]-2-propylsulfanyl-1,3-thiazol-5-one |
| SMILES | CCCSC1=N/C(=C\c2ccc(OCc3ccccc3)cc2)C(=O)S1 |
| InChI | InChI=1S/C20H19NO2S2/c1-2-12-24-20-21-18(19(22)25-20)13-15-8-10-17(11-9-15)23-14-16-6-4-3-5-7-16/h3-11,13H,2,12,14H2,1H3/b18-13- |
| InChIKey | YDVLYWSVMORSPX-AQTBWJFISA-N |
| XLogP | 5.38 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|