C15H11NOS3 — CID 2191251
(4E)-2-benzylsulfanyl-4-(thiophen-3-ylmethylidene)-1,3-thiazol-5-one (PubChem CID 2191251) has the molecular formula C15H11NOS3 and a molecular weight of 317.46 g/mol. Its IUPAC name is (4E)-2-benzylsulfanyl-4-(thiophen-3-ylmethylidene)-1,3-thiazol-5-one.
| Compound Name | (4E)-2-benzylsulfanyl-4-(thiophen-3-ylmethylidene)-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2191251 |
| Molecular Formula | C15H11NOS3 |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | (4E)-2-benzylsulfanyl-4-(thiophen-3-ylmethylidene)-1,3-thiazol-5-one |
| SMILES | O=C1SC(SCc2ccccc2)=N/C1=C/c1ccsc1 |
| InChI | InChI=1S/C15H11NOS3/c17-14-13(8-12-6-7-18-9-12)16-15(20-14)19-10-11-4-2-1-3-5-11/h1-9H,10H2/b13-8+ |
| InChIKey | DGTNRCJOXSDJCJ-MDWZMJQESA-N |
| XLogP | 4.65 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|