C22H24N2O2S2 — CID 2940508
2-benzylsulfanyl-4-[[4-(diethylamino)-2-methoxyphenyl]methylidene]-1,3-thiazol-5-one (PubChem CID 2940508) has the molecular formula C22H24N2O2S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-[[4-(diethylamino)-2-methoxyphenyl]methylidene]-1,3-thiazol-5-one.
| Compound Name | 2-benzylsulfanyl-4-[[4-(diethylamino)-2-methoxyphenyl]methylidene]-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2940508 |
| Molecular Formula | C22H24N2O2S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-benzylsulfanyl-4-[[4-(diethylamino)-2-methoxyphenyl]methylidene]-1,3-thiazol-5-one |
| SMILES | CCN(CC)c1ccc(C=C2N=C(SCc3ccccc3)SC2=O)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O2S2/c1-4-24(5-2)18-12-11-17(20(14-18)26-3)13-19-21(25)28-22(23-19)27-15-16-9-7-6-8-10-16/h6-14H,4-5,15H2,1-3H3 |
| InChIKey | UTDXZQPBMJYDRI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|