C21H16N2O2S2 — CID 1310484
(4Z)-4-[(1-acetylindol-3-yl)methylidene]-2-benzylsulfanyl-1,3-thiazol-5-one (PubChem CID 1310484) has the molecular formula C21H16N2O2S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is (4Z)-4-[(1-acetylindol-3-yl)methylidene]-2-benzylsulfanyl-1,3-thiazol-5-one.
| Compound Name | (4Z)-4-[(1-acetylindol-3-yl)methylidene]-2-benzylsulfanyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 1310484 |
| Molecular Formula | C21H16N2O2S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (4Z)-4-[(1-acetylindol-3-yl)methylidene]-2-benzylsulfanyl-1,3-thiazol-5-one |
| SMILES | CC(=O)n1cc(/C=C2\N=C(SCc3ccccc3)SC2=O)c2ccccc21 |
| InChI | InChI=1S/C21H16N2O2S2/c1-14(24)23-12-16(17-9-5-6-10-19(17)23)11-18-20(25)27-21(22-18)26-13-15-7-3-2-4-8-15/h2-12H,13H2,1H3/b18-11- |
| InChIKey | UNNDSKWTULHTBR-WQRHYEAKSA-N |
| XLogP | 5.21 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|