C17H11ClFNOS2 — CID 2940499
2-[(4-chlorophenyl)methylsulfanyl]-4-[(3-fluorophenyl)methylidene]-1,3-thiazol-5-one (PubChem CID 2940499) has the molecular formula C17H11ClFNOS2 and a molecular weight of 363.87 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-4-[(3-fluorophenyl)methylidene]-1,3-thiazol-5-one.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-4-[(3-fluorophenyl)methylidene]-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2940499 |
| Molecular Formula | C17H11ClFNOS2 |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-4-[(3-fluorophenyl)methylidene]-1,3-thiazol-5-one |
| SMILES | O=C1SC(SCc2ccc(Cl)cc2)=NC1=Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H11ClFNOS2/c18-13-6-4-11(5-7-13)10-22-17-20-15(16(21)23-17)9-12-2-1-3-14(19)8-12/h1-9H,10H2 |
| InChIKey | XVYUJGLQZGIDLQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|