C19H16ClNOS2 — CID 2191147
(4E)-2-[(4-chlorophenyl)methylsulfanyl]-4-[(2,5-dimethylphenyl)methylidene]-1,3-thiazol-5-one (PubChem CID 2191147) has the molecular formula C19H16ClNOS2 and a molecular weight of 373.93 g/mol. Its IUPAC name is (4E)-2-[(4-chlorophenyl)methylsulfanyl]-4-[(2,5-dimethylphenyl)methylidene]-1,3-thiazol-5-one.
| Compound Name | (4E)-2-[(4-chlorophenyl)methylsulfanyl]-4-[(2,5-dimethylphenyl)methylidene]-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2191147 |
| Molecular Formula | C19H16ClNOS2 |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | (4E)-2-[(4-chlorophenyl)methylsulfanyl]-4-[(2,5-dimethylphenyl)methylidene]-1,3-thiazol-5-one |
| SMILES | Cc1ccc(C)c(/C=C2/N=C(SCc3ccc(Cl)cc3)SC2=O)c1 |
| InChI | InChI=1S/C19H16ClNOS2/c1-12-3-4-13(2)15(9-12)10-17-18(22)24-19(21-17)23-11-14-5-7-16(20)8-6-14/h3-10H,11H2,1-2H3/b17-10+ |
| InChIKey | RXPZHXABKXVYHA-LICLKQGHSA-N |
| XLogP | 5.86 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|