C15H9BrClNOS3 — CID 2940755
4-[(5-bromothiophen-2-yl)methylidene]-2-[(4-chlorophenyl)methylsulfanyl]-1,3-thiazol-5-one (PubChem CID 2940755) has the molecular formula C15H9BrClNOS3 and a molecular weight of 430.80 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)methylidene]-2-[(4-chlorophenyl)methylsulfanyl]-1,3-thiazol-5-one.
| Compound Name | 4-[(5-bromothiophen-2-yl)methylidene]-2-[(4-chlorophenyl)methylsulfanyl]-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2940755 |
| Molecular Formula | C15H9BrClNOS3 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 428.87 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)methylidene]-2-[(4-chlorophenyl)methylsulfanyl]-1,3-thiazol-5-one |
| SMILES | O=C1SC(SCc2ccc(Cl)cc2)=NC1=Cc1ccc(Br)s1 |
| InChI | InChI=1S/C15H9BrClNOS3/c16-13-6-5-11(21-13)7-12-14(19)22-15(18-12)20-8-9-1-3-10(17)4-2-9/h1-7H,8H2 |
| InChIKey | ARMSUFPHTTUFLW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|