C21H13ClN2O4S2 — CID 2191832
(4E)-2-[(4-chlorophenyl)methylsulfanyl]-4-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazol-5-one (PubChem CID 2191832) has the molecular formula C21H13ClN2O4S2 and a molecular weight of 456.93 g/mol. Its IUPAC name is (4E)-2-[(4-chlorophenyl)methylsulfanyl]-4-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazol-5-one.
| Compound Name | (4E)-2-[(4-chlorophenyl)methylsulfanyl]-4-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2191832 |
| Molecular Formula | C21H13ClN2O4S2 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | (4E)-2-[(4-chlorophenyl)methylsulfanyl]-4-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazol-5-one |
| SMILES | O=C1SC(SCc2ccc(Cl)cc2)=N/C1=C/c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C21H13ClN2O4S2/c22-14-7-5-13(6-8-14)12-29-21-23-17(20(25)30-21)11-15-9-10-19(28-15)16-3-1-2-4-18(16)24(26)27/h1-11H,12H2/b17-11+ |
| InChIKey | YVKVUAZBSBRIOK-GZTJUZNOSA-N |
| XLogP | 6.41 |
| TPSA | 85.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|