C25H23ClOS — CID 68543687
1-(4-chlorophenyl)-3-(2,5-dimethylphenyl)-2-[(4-methylphenyl)methylsulfanyl]prop-2-en-1-one (PubChem CID 68543687) has the molecular formula C25H23ClOS and a molecular weight of 406.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,5-dimethylphenyl)-2-[(4-methylphenyl)methylsulfanyl]prop-2-en-1-one.
| Compound Name | 1-(4-chlorophenyl)-3-(2,5-dimethylphenyl)-2-[(4-methylphenyl)methylsulfanyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68543687 |
| Molecular Formula | C25H23ClOS |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,5-dimethylphenyl)-2-[(4-methylphenyl)methylsulfanyl]prop-2-en-1-one |
| SMILES | Cc1ccc(CSC(=Cc2cc(C)ccc2C)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H23ClOS/c1-17-5-8-20(9-6-17)16-28-24(15-22-14-18(2)4-7-19(22)3)25(27)21-10-12-23(26)13-11-21/h4-15H,16H2,1-3H3 |
| InChIKey | ASNZKBBBAUBCJI-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|